Products 51762-69-7
CAS 51762-69-7 is the registry number for 9H-Thioxanthene-1-carboxylic acid, 9-oxo-, 96%, 96%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
9-oxothioxanthene-1-carboxylic acid (CAS 51762-69-7) is a chemical compound with the molecular formula C14H8O3S and a molecular weight of 256.28 g/mol. IUPAC name: 9-oxothioxanthene-1-carboxylic acid. InChIKey: XIAMGZGYOUIKGW-UHFFFAOYSA-N.
| Molecular formula | C14H8O3S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 9-oxothioxanthene-1-carboxylic acid |
| InChIKey | XIAMGZGYOUIKGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC=C3S2)C(=O)O |
Computed by PubChem (NCBI)