9H,9'H-2,2'-Bicarbazole, 95%
cas: 350706-55-7 — see every product listed under this CAS number, including other names
9H,9'H-2,2'-Bicarbazole, 95% (CAS 350706-55-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F864581-100MG |
| cas | 350706-55-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 1g | 1997.23 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1432.81 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| Chemat | 5g | 1480.40 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1408.42 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-(9H-carbazol-2-yl)-9H-carbazole (CAS 350706-55-7) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 2-(9H-carbazol-2-yl)-9H-carbazole. InChIKey: XZGICZPYQOUKIN-UHFFFAOYSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-(9H-carbazol-2-yl)-9H-carbazole |
| InChIKey | XZGICZPYQOUKIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)C4=CC5=C(C=C4)C6=CC=CC=C6N5 |
Computed by PubChem (NCBI)