Products 350706-55-7
CAS 350706-55-7 is the registry number for 9H,9'H-2,2'-Bicarbazole, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(9H-carbazol-2-yl)-9H-carbazole (CAS 350706-55-7) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 2-(9H-carbazol-2-yl)-9H-carbazole. InChIKey: XZGICZPYQOUKIN-UHFFFAOYSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-(9H-carbazol-2-yl)-9H-carbazole |
| InChIKey | XZGICZPYQOUKIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)C4=CC5=C(C=C4)C6=CC=CC=C6N5 |
Computed by PubChem (NCBI)