cas: 73500-82-0 — see every product listed under this CAS number, including other names
9H-Carbazole-9-carbonyl chloride 98% (CAS 73500-82-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A909506-250mg |
| cas | 73500-82-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2951.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A909506 |
Carbazole-9-carbonyl chloride (CAS 73500-82-0) is a chemical compound with the molecular formula C13H8ClNO and a molecular weight of 229.66 g/mol. IUPAC name: carbazole-9-carbonyl chloride. InChIKey: RCENRFKQKSIRLA-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | carbazole-9-carbonyl chloride |
| InChIKey | RCENRFKQKSIRLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C(=O)Cl |
Computed by PubChem (NCBI)