cas: 73500-82-0 — see every product listed under this CAS number, including other names
Carbazole-9-carbonyl Chloride, >98.0%(GC)(T) (CAS 73500-82-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1031-1G |
| cas | 73500-82-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 339.62 Pln | |
| TCI | 5g | 1032.95 Pln | |
| TCI | 25g | 3255.55 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Carbazole-9-carbonyl chloride (CAS 73500-82-0) is a chemical compound with the molecular formula C13H8ClNO and a molecular weight of 229.66 g/mol. IUPAC name: carbazole-9-carbonyl chloride. InChIKey: RCENRFKQKSIRLA-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | carbazole-9-carbonyl chloride |
| InChIKey | RCENRFKQKSIRLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C(=O)Cl |
Computed by PubChem (NCBI)