cas: 147687-15-8 — see every product listed under this CAS number, including other names
9H-Fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate, 98%, 98% (CAS 147687-15-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXKZ-1g |
| cas | 147687-15-8 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 100g | 818.00 Pln | |
| Chemat | 10g | 170.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate (CAS 147687-15-8) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate. InChIKey: INKRUGORSXCMAT-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate |
| InChIKey | INKRUGORSXCMAT-UHFFFAOYSA-N |
| SMILES | CN(CCO)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)