cas: 147687-15-8 — see every product listed under this CAS number, including other names
9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate, 98% (CAS 147687-15-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F402252-5G |
| cas | 147687-15-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 924.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate (CAS 147687-15-8) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate. InChIKey: INKRUGORSXCMAT-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate |
| InChIKey | INKRUGORSXCMAT-UHFFFAOYSA-N |
| SMILES | CN(CCO)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)