cas: 147687-15-8 — see every product listed under this CAS number, including other names
Fmoc-Sar-ol 98% (CAS 147687-15-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A636413-1g |
| cas | 147687-15-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 932.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A636413 |
9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate (CAS 147687-15-8) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate. InChIKey: INKRUGORSXCMAT-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)-N-methylcarbamate |
| InChIKey | INKRUGORSXCMAT-UHFFFAOYSA-N |
| SMILES | CN(CCO)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)