9H-Fluorene-2-sulfonyl chloride, 95%
cas: 13354-17-1 — see every product listed under this CAS number, including other names
9H-Fluorene-2-sulfonyl chloride, 95% (CAS 13354-17-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg. Offered by: Combi-blocks, AmBeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | HE-2567-250mg |
| cas | 13354-17-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 10g | 14880.25 Pln | |
| AmBeed | 5g | 10648.75 Pln | |
| Ambeed | 100mg | 503.88 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1477.31 Pln | |
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 1g | 1835.60 Pln | |
| BLDpharm | 100mg | 536.50 Pln | |
| BLDpharm | 250mg | 636.47 Pln | |
| BLDpharm | 1g | 1586.13 Pln | |
| Fluorochem | 250mg | 1455.76 Pln | |
| Fluorochem | 1g | 3392.57 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
9H-fluorene-2-sulfonyl chloride (CAS 13354-17-1) is a chemical compound with the molecular formula C13H9ClO2S and a molecular weight of 264.73 g/mol. IUPAC name: 9H-fluorene-2-sulfonyl chloride. InChIKey: OOCRPNTZVSMEIJ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2S |
|---|---|
| Molecular weight | 264.73 g/mol |
| IUPAC name | 9H-fluorene-2-sulfonyl chloride |
| InChIKey | OOCRPNTZVSMEIJ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C=C(C=C3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)