CAS 13354-17-1 is the registry number for 9H-Fluorene-2-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
9H-fluorene-2-sulfonyl chloride (CAS 13354-17-1) is a chemical compound with the molecular formula C13H9ClO2S and a molecular weight of 264.73 g/mol. IUPAC name: 9H-fluorene-2-sulfonyl chloride. InChIKey: OOCRPNTZVSMEIJ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2S |
|---|---|
| Molecular weight | 264.73 g/mol |
| IUPAC name | 9H-fluorene-2-sulfonyl chloride |
| InChIKey | OOCRPNTZVSMEIJ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C=C(C=C3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)