Products 950070-11-8

CAS 950070-11-8 is the registry number for 3-[5-(2-Chlorophenyl)thien-2-yl]acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoic acid (CAS 950070-11-8) is a chemical compound with the molecular formula C13H9ClO2S and a molecular weight of 264.73 g/mol. IUPAC name: (E)-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoic acid. InChIKey: GJSGWEBGESDTBT-SOFGYWHQSA-N.

Identity
Molecular formulaC13H9ClO2S
Molecular weight264.73 g/mol
IUPAC name(E)-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoic acid
InChIKeyGJSGWEBGESDTBT-SOFGYWHQSA-N
SMILESC1=CC=C(C(=C1)C2=CC=C(S2)/C=C/C(=O)O)Cl

Computed by PubChem (NCBI)