cas: 24223-07-2 — see every product listed under this CAS number, including other names
9H-pyrido(3,4-b)indole 2-oxide, 98% (CAS 24223-07-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1356856-250mg |
| cas | 24223-07-2 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 5902.96 Pln | |
| AmBeed | 1g | 11911.69 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-hydroxypyrido[3,4-b]indole (CAS 24223-07-2) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 2-hydroxypyrido[3,4-b]indole. InChIKey: IRDLFNVGQPUJLH-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-hydroxypyrido[3,4-b]indole |
| InChIKey | IRDLFNVGQPUJLH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C=CN(C=C3N=C2C=C1)O |
Computed by PubChem (NCBI)