CAS 861393-28-4 appears in our catalog under these names: A-740003, 98+%, A-740003/ 99.51% (existing batch purity), A–740003, A-740003 97%, A-740003. Offered by: AmBeed, TargetMol, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25mg, 5mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg, 50 mg.
N-[1-[[(cyanoamino)-(quinolin-5-ylamino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide (CAS 861393-28-4) is a chemical compound with the molecular formula C26H30N6O3 and a molecular weight of 474.6 g/mol. IUPAC name: N-[1-[[(cyanoamino)-(quinolin-5-ylamino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide. InChIKey: PUHSRMSFDASMAE-UHFFFAOYSA-N.
| Molecular formula | C26H30N6O3 |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | N-[1-[[(cyanoamino)-(quinolin-5-ylamino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
| InChIKey | PUHSRMSFDASMAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(NC(=O)CC1=CC(=C(C=C1)OC)OC)N=C(NC#N)NC2=CC=CC3=C2C=CC=N3 |
Computed by PubChem (NCBI)