Products 162705-22-8
CAS 162705-22-8 appears in our catalog under these names: AC 7739/ 99.38% (existing batch purity), AVE-8063 (hydrochloride). Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 10 mg.
2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline;hydrochloride (CAS 162705-22-8) is a chemical compound with the molecular formula C18H22ClNO4 and a molecular weight of 351.8 g/mol. IUPAC name: 2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline;hydrochloride. InChIKey: SCJGXQSJGQUCFA-YSMBQZINSA-N.
| Molecular formula | C18H22ClNO4 |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | 2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline;hydrochloride |
| InChIKey | SCJGXQSJGQUCFA-YSMBQZINSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)N.Cl |
Computed by PubChem (NCBI)