CAS 873305-35-2 appears in our catalog under these names: AIM-100/ 98.75% (existing batch purity), AIM–100, AIM-100, (S)-5,6-Diphenyl-N-((tetrahydrofuran-2-yl)methyl)furo[2,3-d]pyrimidin-4-amine, 98%, 98%, AIM-100, 99.95%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 500mg.
N-[[(2S)-oxolan-2-yl]methyl]-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine (CAS 873305-35-2) is a chemical compound with the molecular formula C23H21N3O2 and a molecular weight of 371.4 g/mol. IUPAC name: N-[[(2S)-oxolan-2-yl]methyl]-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine. InChIKey: XNFHHOXCDUAYSR-SFHVURJKSA-N.
| Molecular formula | C23H21N3O2 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | N-[[(2S)-oxolan-2-yl]methyl]-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine |
| InChIKey | XNFHHOXCDUAYSR-SFHVURJKSA-N |
| SMILES | C1C[C@H](OC1)CNC2=C3C(=C(OC3=NC=N2)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)