Products 2101200-10-4
CAS 2101200-10-4 appears in our catalog under these names: PROTAC BRD4–binding moiety 1, PROTAC BRD4-binding moiety 1, PROTAC BRD4-binding moiety 1, 99.10%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 25 mg, 5 mg, 10 mg, 50 mg.
6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-4-phenyl-3-prop-2-ynyl-4H-quinazolin-2-one (CAS 2101200-10-4) is a chemical compound with the molecular formula C23H21N3O2 and a molecular weight of 371.4 g/mol. IUPAC name: 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-4-phenyl-3-prop-2-ynyl-4H-quinazolin-2-one. InChIKey: ZKJVDZJHVLJOKO-UHFFFAOYSA-N.
| Molecular formula | C23H21N3O2 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-4-phenyl-3-prop-2-ynyl-4H-quinazolin-2-one |
| InChIKey | ZKJVDZJHVLJOKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC3=C(C=C2)N(C(=O)N(C3C4=CC=CC=C4)CC#C)C |
Computed by PubChem (NCBI)
Synonyms:
PROTAC BRD4-binding moiety 1, orb1987812