CAS 1007377-55-0 appears in our catalog under these names: AKB-6899, 98%, AKB–6899, AKB-6899/ 97.11% (existing batch purity), AKB-6899, AKB-6899, 97.87% ,, 97.87% ,. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 1mg, 2mg, 5 mg.
2-[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid (CAS 1007377-55-0) is a chemical compound with the molecular formula C14H11FN2O4 and a molecular weight of 290.25 g/mol. IUPAC name: 2-[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid. InChIKey: PXWOWORYDKAEJO-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O4 |
|---|---|
| Molecular weight | 290.25 g/mol |
| IUPAC name | 2-[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid |
| InChIKey | PXWOWORYDKAEJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC(=C(N=C2)C(=O)NCC(=O)O)O |
Computed by PubChem (NCBI)