Products 1442684-77-6
CAS 1442684-77-6 appears in our catalog under these names: AM-2394/ 99.58% (existing batch purity), AM2394, AM 2394, AM-2394 99%, AM-2394, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
1-[5-[6-(2-hydroxy-2-methylpropoxy)-3-pyridinyl]-4-[(5-methyl-3-pyridinyl)oxy]-2-pyridinyl]-3-methylurea (CAS 1442684-77-6) is a chemical compound with the molecular formula C22H25N5O4 and a molecular weight of 423.5 g/mol. IUPAC name: 1-[5-[6-(2-hydroxy-2-methylpropoxy)-3-pyridinyl]-4-[(5-methyl-3-pyridinyl)oxy]-2-pyridinyl]-3-methylurea. InChIKey: QUISANLDBDCMPD-UHFFFAOYSA-N.
| Molecular formula | C22H25N5O4 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 1-[5-[6-(2-hydroxy-2-methylpropoxy)-3-pyridinyl]-4-[(5-methyl-3-pyridinyl)oxy]-2-pyridinyl]-3-methylurea |
| InChIKey | QUISANLDBDCMPD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)OC2=CC(=NC=C2C3=CN=C(C=C3)OCC(C)(C)O)NC(=O)NC |
Computed by PubChem (NCBI)