CAS 931417-26-4 appears in our catalog under these names: ANI-7/ 99.21% (existing batch purity), ANI–7, ANI-7, ANI-7 98%, (Z)-2-(3,4-Dichlorophenyl)-3-(1H-pyrrol-2-yl)acrylonitrile. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg, 1mg.
(Z)-2-(3,4-dichlorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile (CAS 931417-26-4) is a chemical compound with the molecular formula C13H8Cl2N2 and a molecular weight of 263.12 g/mol. IUPAC name: (Z)-2-(3,4-dichlorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile. InChIKey: IJJHHDLGGYDXGD-UXBLZVDNSA-N.
| Molecular formula | C13H8Cl2N2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | (Z)-2-(3,4-dichlorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile |
| InChIKey | IJJHHDLGGYDXGD-UXBLZVDNSA-N |
| SMILES | C1=CNC(=C1)/C=C(\C#N)/C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)