Products 131947-29-0
CAS 131947-29-0 is the registry number for 3-Chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
3-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine (CAS 131947-29-0) is a chemical compound with the molecular formula C13H8Cl2N2 and a molecular weight of 263.12 g/mol. IUPAC name: 3-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine. InChIKey: LSWMDIMFMXXPSG-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 3-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine |
| InChIKey | LSWMDIMFMXXPSG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)Cl)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)