CAS 1061354-48-0 appears in our catalog under these names: AVN-101/ 99.73% (existing batch purity), AVN–101 HCl, 2,8-Dimethyl-5-phenethyl-2,3,4,5-tetrahydro-1H-pyrido(4,3-b)indole hydrochloride, AVN-101 (hydrochloride), 99.59%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 200mg.
2,8-dimethyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride (CAS 1061354-48-0) is a chemical compound with the molecular formula C21H25ClN2 and a molecular weight of 340.9 g/mol. IUPAC name: 2,8-dimethyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride. InChIKey: RKLJJDFIWWRTEJ-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN2 |
|---|---|
| Molecular weight | 340.9 g/mol |
| IUPAC name | 2,8-dimethyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride |
| InChIKey | RKLJJDFIWWRTEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)