CAS 1071098-42-4 appears in our catalog under these names: AZA1/ 98.59% (existing batch purity), AZA1, N2,N4-bis(2-methyl-1H-indol-5-yl)pyrimidine-2,4-diamine, 99.75% ,, 99.75% ,, AZA1, 98.17%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
2-N,4-N-bis(2-methyl-1H-indol-5-yl)pyrimidine-2,4-diamine (CAS 1071098-42-4) is a chemical compound with the molecular formula C22H20N6 and a molecular weight of 368.4 g/mol. IUPAC name: 2-N,4-N-bis(2-methyl-1H-indol-5-yl)pyrimidine-2,4-diamine. InChIKey: SYWHWWKOIJCMKF-UHFFFAOYSA-N.
| Molecular formula | C22H20N6 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 2-N,4-N-bis(2-methyl-1H-indol-5-yl)pyrimidine-2,4-diamine |
| InChIKey | SYWHWWKOIJCMKF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=C2)NC3=NC(=NC=C3)NC4=CC5=C(C=C4)NC(=C5)C |
Computed by PubChem (NCBI)