Ac-D-Bpa-OH, 95%, 95%
cas: 104504-42-9 — see every product listed under this CAS number, including other names
Ac-D-Bpa-OH, 95%, 95% (CAS 104504-42-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Y7T-100mg |
| cas | 104504-42-9 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1763.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-acetamido-3-(4-benzoylphenyl)propanoic acid (CAS 104504-42-9) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (2R)-2-acetamido-3-(4-benzoylphenyl)propanoic acid. InChIKey: WLYJTWQCNXWBRA-MRXNPFEDSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(4-benzoylphenyl)propanoic acid |
| InChIKey | WLYJTWQCNXWBRA-MRXNPFEDSA-N |
| SMILES | CC(=O)N[C@H](CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)