Products 104504-42-9
CAS 104504-42-9 appears in our catalog under these names: Ac-d-bpa-oh, 98%, (R)-2-Acetamido-3-(4-benzoylphenyl)propanoic acid, 97%, Ac–p–Bz–D–Phe–OH, Ac-D-Bpa-OH, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(2R)-2-acetamido-3-(4-benzoylphenyl)propanoic acid (CAS 104504-42-9) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (2R)-2-acetamido-3-(4-benzoylphenyl)propanoic acid. InChIKey: WLYJTWQCNXWBRA-MRXNPFEDSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(4-benzoylphenyl)propanoic acid |
| InChIKey | WLYJTWQCNXWBRA-MRXNPFEDSA-N |
| SMILES | CC(=O)N[C@H](CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)