CAS 79990-15-1 appears in our catalog under these names: Fmoc-D-Ala-OH H2O, 98%, Fmoc-D-Ala-OH, 98%, N-Fmoc-D-alanine, >95% (HPLC), Fmoc–D–Ala–OH, Fmoc-D-Ala-OH*H2O. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 100g, 25g, 1kg, 500g, 50g, 250g, 1000g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 79990-15-1) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-LLVKDONJSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-LLVKDONJSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)