cas: 1233495-04-9 — see every product listed under this CAS number, including other names
Ac-D-Glu(OtBu)-OH, 98% (CAS 1233495-04-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A428643-1g |
| cas | 1233495-04-9 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1265.94 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 453.20 Pln | |
| Chemat | 25g | 1240.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 1233495-04-9) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: FALCCLKESWGSNI-MRVPVSSYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | FALCCLKESWGSNI-MRVPVSSYSA-N |
| SMILES | CC(=O)N[C@H](CCC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)