CAS 1233495-04-9 appears in our catalog under these names: Ac-D-Glu(OtBu)-OH, 98%, 98%, Ac-D-Glu(OtBu)-OH, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
(2R)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 1233495-04-9) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: FALCCLKESWGSNI-MRVPVSSYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | FALCCLKESWGSNI-MRVPVSSYSA-N |
| SMILES | CC(=O)N[C@H](CCC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)