Ac-D-Leu-OH 99%
cas: 19764-30-8 — see every product listed under this CAS number, including other names
Ac-D-Leu-OH 99% (CAS 19764-30-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A221188-5g |
| cas | 19764-30-8 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 136.75 Pln | |
| Ambeed | 25g | 181.25 Pln | |
| Ambeed | 100g | 253.56 Pln | |
| Ambeed | 500g | 982.25 Pln | |
| Ambeed | 1000g | 1621.94 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A221188 |
N-acetyl-D-leucine is the N-acetyl derivative of D-leucine. It is a N-acetyl-D-amino acid and a D-leucine derivative. It is a conjugate acid of a N-acetyl-D-leucinate. It is an enantiomer of a N-acetyl-L-leucine.
Source: ChEBI
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (2R)-2-acetamido-4-methylpentanoic acid |
| InChIKey | WXNXCEHXYPACJF-SSDOTTSWSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)