N-Acetyl-D-leucine, 99%, 99%
cas: 19764-30-8 — see every product listed under this CAS number, including other names
N-Acetyl-D-leucine, 99%, 99% (CAS 19764-30-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AY6-1kg |
| cas | 19764-30-8 |
| size | 1kg |
| availability | 7000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 1326.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 203.60 Pln | |
| Chemat | 500g | 768.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-acetyl-D-leucine is the N-acetyl derivative of D-leucine. It is a N-acetyl-D-amino acid and a D-leucine derivative. It is a conjugate acid of a N-acetyl-D-leucinate. It is an enantiomer of a N-acetyl-L-leucine.
Source: ChEBI
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (2R)-2-acetamido-4-methylpentanoic acid |
| InChIKey | WXNXCEHXYPACJF-SSDOTTSWSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)