cas: 1595290-47-3 — see every product listed under this CAS number, including other names
Acetamide, N-(1-methylethyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-, 95+%, 95+% (CAS 1595290-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYJL-100mg |
| cas | 1595290-47-3 |
| size | 100mg |
| availability | 1.33g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 923.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
N-propan-2-yl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide (CAS 1595290-47-3) is a chemical compound with the molecular formula C17H26BNO4 and a molecular weight of 319.2 g/mol. IUPAC name: N-propan-2-yl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide. InChIKey: RHGYOLJSJSOEMH-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | N-propan-2-yl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide |
| InChIKey | RHGYOLJSJSOEMH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC(=O)NC(C)C |
Computed by PubChem (NCBI)