Adamantane-1-carboxamide, 97%
cas: 5511-18-2 — see every product listed under this CAS number, including other names
Adamantane-1-carboxamide, 97% (CAS 5511-18-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A306518-1g |
| cas | 5511-18-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 10g | 698.56 Pln | |
| Ambeed | 25g | 1021.19 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Chemat | 10g | 856.40 Pln | |
| Chemat | 25g | 1706.00 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 331.02 Pln | |
| BLDpharm | 5g | 847.50 Pln | |
| BLDpharm | 25g | 2274.78 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Adamantane-1-carboxamide (CAS 5511-18-2) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: adamantane-1-carboxamide. InChIKey: CKBZJTAMRPPVSR-UHFFFAOYSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | adamantane-1-carboxamide |
| InChIKey | CKBZJTAMRPPVSR-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)N |
Computed by PubChem (NCBI)
Synonyms:
Tricyclo(3.3.1.13,7)decane-1-carboxamide, adamantane-1-carboxamide, adamantanecarboxamide, admantane-1-carboxamide, tricyclo[3.3.1.1~3,7~]decane-1-carboxamide, 9-Minocycline-d6 Disulfate Salt, Tricyclo(3.3.1.1(sup 3,7))decane-1-carboxamide, 1-Adamantyl-carboxamide, 1-adamantane carboxamide, Oprea1_331138