CAS 5511-18-2 appears in our catalog under these names: 1-Adamantanecarboxamide, 1–Adamantanecarboxamide, 1-Adamantane carboxamide, Adamantane-1-carboxamide 97%, Adamantane-1-carboxamide, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 0,05kg, 0,1kg, 0,25kg, 0,5kg, 1kg.
Adamantane-1-carboxamide (CAS 5511-18-2) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: adamantane-1-carboxamide. InChIKey: CKBZJTAMRPPVSR-UHFFFAOYSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | adamantane-1-carboxamide |
| InChIKey | CKBZJTAMRPPVSR-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)N |
Computed by PubChem (NCBI)