CAS 34240-05-6 appears in our catalog under these names: Adenosine Dialdehyde (ADOX)/ 95%, Adox, ADENOSINE, PERIODATE OXIDIZED, Adenosine dialdehyde, ≥95%, ≥95%, Adenosine dialdehyde, 99.18%. Offered by: TargetMol, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 10mM/1mL.
2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-hydroxypropanal (CAS 34240-05-6) is a chemical compound with the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. IUPAC name: 2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-hydroxypropanal. InChIKey: ILMNSCQOSGKTNZ-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O4 |
|---|---|
| Molecular weight | 265.23 g/mol |
| IUPAC name | 2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-hydroxypropanal |
| InChIKey | ILMNSCQOSGKTNZ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)C(C=O)OC(CO)C=O)N |
Computed by PubChem (NCBI)