Products 877176-23-3
CAS 877176-23-3 appears in our catalog under these names: Aderamastat/ 99.35% (existing batch purity), Aderamastat, Aderamastat 99%, Aderamastat, 99.82%, Aderamastat, 98%, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 25 mg.
5-[3-[4-[(3-methylphenyl)methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione (CAS 877176-23-3) is a chemical compound with the molecular formula C21H18N2O4S and a molecular weight of 394.4 g/mol. IUPAC name: 5-[3-[4-[(3-methylphenyl)methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione. InChIKey: CXEKSVVDMIAMLF-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O4S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 5-[3-[4-[(3-methylphenyl)methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione |
| InChIKey | CXEKSVVDMIAMLF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)COC2=CC=C(C=C2)SC3=C(OC=C3)C4C(=O)NC(=O)N4 |
Computed by PubChem (NCBI)