CAS 2482-00-0 appears in our catalog under these names: Agmatine Sulfate, >95% (HPLC), Agmatine sulfate, ≥98%, Agmatine sulfate/ 99.56% (existing batch purity), Agmatine sulfate, Agmatine sulfate, 97% . Offered by: TRC, AmBeed, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 10g, 1g, 25g, 5g, 250mg, 50g, 1000g.
2-(4-aminobutyl)guanidine;sulfuric acid (CAS 2482-00-0) is a chemical compound with the molecular formula C5H16N4O4S and a molecular weight of 228.27 g/mol. IUPAC name: 2-(4-aminobutyl)guanidine;sulfuric acid. InChIKey: PTAYFGHRDOMJGC-UHFFFAOYSA-N.
| Molecular formula | C5H16N4O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 2-(4-aminobutyl)guanidine;sulfuric acid |
| InChIKey | PTAYFGHRDOMJGC-UHFFFAOYSA-N |
| SMILES | C(CCN=C(N)N)CN.OS(=O)(=O)O |
Computed by PubChem (NCBI)