Products 56681-55-1

CAS 56681-55-1 is the registry number for Alachlor-2-hydroxy 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.

Structural formula: {0} (CAS {1})

N-(2,6-diethylphenyl)-2-hydroxy-N-(methoxymethyl)acetamide (CAS 56681-55-1) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: N-(2,6-diethylphenyl)-2-hydroxy-N-(methoxymethyl)acetamide. InChIKey: CEFLNPUKMSWYFB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO3
Molecular weight251.32 g/mol
IUPAC nameN-(2,6-diethylphenyl)-2-hydroxy-N-(methoxymethyl)acetamide
InChIKeyCEFLNPUKMSWYFB-UHFFFAOYSA-N
SMILESCCC1=C(C(=CC=C1)CC)N(COC)C(=O)CO

Computed by PubChem (NCBI)