Products 641-39-4
CAS 641-39-4 appears in our catalog under these names: Allomatrine/ 99.87% (existing batch purity), Allomatrine, (7aS,13aR,13bR,13cR)-Dodecahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one, 98%+(GC-MS),RG, 98%+(GC-MS),RG, Allomatrine, 99.36%, Allomatrine, min. 95 %, 25 mg. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Roth. Available pack sizes: 100mg, 500mg, 50mg, 25mg, 250mg, 1g, 5g, 25g.
(1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (CAS 641-39-4) is a chemical compound with the molecular formula C15H24N2O and a molecular weight of 248.36 g/mol. IUPAC name: (1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one. InChIKey: ZSBXGIUJOOQZMP-KYEXWDHISA-N.
| Molecular formula | C15H24N2O |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | (1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| InChIKey | ZSBXGIUJOOQZMP-KYEXWDHISA-N |
| SMILES | C1C[C@@H]2[C@H]3CCCN4[C@@H]3[C@@H](CCC4)CN2C(=O)C1 |
Computed by PubChem (NCBI)