CAS 1820575-88-9 is the registry number for rac-[(2S,3R)-1-[(4-methoxyphenyl)methyl]-3-methylpiperidin-2-yl]methanamine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[(2S,3R)-1-[(4-methoxyphenyl)methyl]-3-methylpiperidin-2-yl]methanamine (CAS 1820575-88-9) is a chemical compound with the molecular formula C15H24N2O and a molecular weight of 248.36 g/mol. IUPAC name: [(2S,3R)-1-[(4-methoxyphenyl)methyl]-3-methylpiperidin-2-yl]methanamine. InChIKey: LHVVGCIKOHNHPF-IUODEOHRSA-N.
| Molecular formula | C15H24N2O |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | [(2S,3R)-1-[(4-methoxyphenyl)methyl]-3-methylpiperidin-2-yl]methanamine |
| InChIKey | LHVVGCIKOHNHPF-IUODEOHRSA-N |
| SMILES | C[C@@H]1CCCN([C@@H]1CN)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)