CAS 88330-32-9 is the registry number for Amino-BCheptane-COOH (S,R,S,R/R,S,R,S). Offered by: Iris Biotech. Available pack sizes: 1g.
(1R,2S,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid (CAS 88330-32-9) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: JSYLGUSANAWARQ-JRTVQGFMSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | JSYLGUSANAWARQ-JRTVQGFMSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H]([C@@H]2N)C(=O)O |
Computed by PubChem (NCBI)