Amino-PEG5-Boc, 99.65%
cas: 1446282-18-3 — see every product listed under this CAS number, including other names
Amino-PEG5-Boc, 99.65% (CAS 1446282-18-3) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 100 mg, 5 g, 250 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-140194-10 g |
| cas | 1446282-18-3 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 3719.10 Pln | |
| MedChemExpress | 25 g | 7318.20 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 2014.75 Pln | |
| MedChemExpress | 250 mg | 287.18 Pln | |
| MedChemExpress | 1 g | 672.64 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.65% |
Tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1446282-18-3) is a chemical compound with the molecular formula C17H35NO7 and a molecular weight of 365.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: XSTIRQZQKAJSIM-UHFFFAOYSA-N.
| Molecular formula | C17H35NO7 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | XSTIRQZQKAJSIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)
Synonyms:
Amino-PEG5-t-butyl ester, Amino-PEG5-Boc, 4,7,10,13,16-Pentaoxaoctadecanoic acid, 18-amino-, 1,1-dimethylethyl ester, H2N-PEG5-CH2CH2COOtBu, Amino-PEG5-COOtBu, Tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate, HN-PEG-CHCHCOOtBu, H2N-PEG5-tBu, Amino-PEG5-t-butylester, orb1909526