cas: 1446282-18-3 — see every product listed under this CAS number, including other names
AMINO-PEG5-T-BUTYL ESTER, 95% (CAS 1446282-18-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F542369-250MG |
| cas | 1446282-18-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1221.46 Pln | |
| Fluorochem | 10g | 2137.81 Pln | |
| Fluorochem | 25g | 4433.87 Pln | |
| Fluorochem | 100g | 17413.68 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1446282-18-3) is a chemical compound with the molecular formula C17H35NO7 and a molecular weight of 365.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: XSTIRQZQKAJSIM-UHFFFAOYSA-N.
| Molecular formula | C17H35NO7 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | XSTIRQZQKAJSIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)