cas: 1446282-18-3 — see every product listed under this CAS number, including other names
Amino-PEG5-Boc (CAS 1446282-18-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T14244-10mg |
| cas | 1446282-18-3 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 10mg | 386.15 Pln | |
| TargetMol | 25mg | 458.82 Pln | |
| TargetMol | 50mg | 591.86 Pln | |
| TargetMol | 100mg | 797.57 Pln | |
| TargetMol | 500mg | 1508.06 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 33 days |
Tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1446282-18-3) is a chemical compound with the molecular formula C17H35NO7 and a molecular weight of 365.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: XSTIRQZQKAJSIM-UHFFFAOYSA-N.
| Molecular formula | C17H35NO7 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | XSTIRQZQKAJSIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)