cas: 1818294-44-8 — see every product listed under this CAS number, including other names
Amino-PEG9-Boc 98% (CAS 1818294-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A986411-100mg |
| cas | 1818294-44-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 1076.81 Pln | |
| Ambeed | 5g | 3235.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A986411 |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-44-8) is a chemical compound with the molecular formula C25H51NO11 and a molecular weight of 541.7 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: PPVFMACVSAAZFR-UHFFFAOYSA-N.
| Molecular formula | C25H51NO11 |
|---|---|
| Molecular weight | 541.7 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | PPVFMACVSAAZFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)