Amino-PEG9-Boc, 95%
cas: 1818294-44-8 — see every product listed under this CAS number, including other names
Amino-PEG9-Boc, 95% (CAS 1818294-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554727-100MG |
| cas | 1818294-44-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 3309.27 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-44-8) is a chemical compound with the molecular formula C25H51NO11 and a molecular weight of 541.7 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: PPVFMACVSAAZFR-UHFFFAOYSA-N.
| Molecular formula | C25H51NO11 |
|---|---|
| Molecular weight | 541.7 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | PPVFMACVSAAZFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)