cas: 1818294-44-8 — see every product listed under this CAS number, including other names
tert-Butyl 1-amino-3,6,9,12,15,18,21,24,27-nonaoxatriacontan-30-oate, 98%, 98% (CAS 1818294-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AT0E-100mg |
| cas | 1818294-44-8 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 765.20 Pln | |
| Chemat | 5g | 2402.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-44-8) is a chemical compound with the molecular formula C25H51NO11 and a molecular weight of 541.7 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: PPVFMACVSAAZFR-UHFFFAOYSA-N.
| Molecular formula | C25H51NO11 |
|---|---|
| Molecular weight | 541.7 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | PPVFMACVSAAZFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)