cas: 853-68-9 — see every product listed under this CAS number, including other names
Anthraquinone-2,6-disulfonic acid disodium salt, 98% (CAS 853-68-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F988556-1G |
| cas | 853-68-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 10g | 1205.84 Pln | |
| Fluorochem | 25g | 1872.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Disodium;9,10-dioxoanthracene-2,6-disulfonate (CAS 853-68-9) is a chemical compound with the molecular formula C14H6Na2O8S2 and a molecular weight of 412.3 g/mol. IUPAC name: disodium;9,10-dioxoanthracene-2,6-disulfonate. InChIKey: PKOVWEHDVFYKHL-UHFFFAOYSA-L.
| Molecular formula | C14H6Na2O8S2 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | disodium;9,10-dioxoanthracene-2,6-disulfonate |
| InChIKey | PKOVWEHDVFYKHL-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)[O-])C(=O)C3=C(C2=O)C=C(C=C3)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)