cas: 853-68-9 — see every product listed under this CAS number, including other names
Disodium Anthraquinone-2,6-disulfonate, 98%, 98% (CAS 853-68-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PRA-100mg |
| cas | 853-68-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Disodium;9,10-dioxoanthracene-2,6-disulfonate (CAS 853-68-9) is a chemical compound with the molecular formula C14H6Na2O8S2 and a molecular weight of 412.3 g/mol. IUPAC name: disodium;9,10-dioxoanthracene-2,6-disulfonate. InChIKey: PKOVWEHDVFYKHL-UHFFFAOYSA-L.
| Molecular formula | C14H6Na2O8S2 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | disodium;9,10-dioxoanthracene-2,6-disulfonate |
| InChIKey | PKOVWEHDVFYKHL-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)[O-])C(=O)C3=C(C2=O)C=C(C=C3)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)