cas: 853-68-9 — see every product listed under this CAS number, including other names
Disodium Anthraquinone-2,6-disulfonate, >98.0%(HPLC)(T) (CAS 853-68-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0308-5G |
| cas | 853-68-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 1101.80 Pln | |
| TCI | 25g | 2739.24 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Disodium;9,10-dioxoanthracene-2,6-disulfonate (CAS 853-68-9) is a chemical compound with the molecular formula C14H6Na2O8S2 and a molecular weight of 412.3 g/mol. IUPAC name: disodium;9,10-dioxoanthracene-2,6-disulfonate. InChIKey: PKOVWEHDVFYKHL-UHFFFAOYSA-L.
| Molecular formula | C14H6Na2O8S2 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | disodium;9,10-dioxoanthracene-2,6-disulfonate |
| InChIKey | PKOVWEHDVFYKHL-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)[O-])C(=O)C3=C(C2=O)C=C(C=C3)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)