Antibacterial agent 26
cas: 75369-40-3 — see every product listed under this CAS number, including other names
Antibacterial agent 26 (CAS 75369-40-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC63959-1 |
| cas | 75369-40-3 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 601.72 Pln | |
| GLPBio | 10mg | 1154.02 Pln | |
| GLPBio | 25mg | 1743.76 Pln | |
| GLPBio | 5mg | 877.87 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 924.67 Pln | |
| GLPBio | 50mg | 2394.35 Pln | |
| Chemat | 1mg | 155.60 Pln | |
| Chemat | 5mg | 309.20 Pln | |
| Chemat | 10mg | 472.40 Pln | |
| Chemat | 25mg | 798.80 Pln | |
| Chemat | 50mg | 1178.00 Pln | |
| Chemat | 100mg | 1629.20 Pln | |
| Chemat | 200mg | 2210.00 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate (CAS 75369-40-3) is a chemical compound with the molecular formula C19H17N5O2 and a molecular weight of 347.4 g/mol. IUPAC name: methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate. InChIKey: BHSTYBXRXPZJCW-UHFFFAOYSA-N.
| Molecular formula | C19H17N5O2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate |
| InChIKey | BHSTYBXRXPZJCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CN2C=CC3=C2C=CC4=C3C(=NC(=N4)N)N |
Computed by PubChem (NCBI)