Products 75369-40-3
CAS 75369-40-3 appears in our catalog under these names: Antibacterial agent 26/ 97.48% (existing batch purity), Antibacterial agent 26, Antibacterial agent 26, 98.07%, Antibacterial agent 26. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 100 mg.
Methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate (CAS 75369-40-3) is a chemical compound with the molecular formula C19H17N5O2 and a molecular weight of 347.4 g/mol. IUPAC name: methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate. InChIKey: BHSTYBXRXPZJCW-UHFFFAOYSA-N.
| Molecular formula | C19H17N5O2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate |
| InChIKey | BHSTYBXRXPZJCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CN2C=CC3=C2C=CC4=C3C(=NC(=N4)N)N |
Computed by PubChem (NCBI)